C22H27NO4Si — CID 141439632
4-[tert-butyl(diphenyl)silyl]oxy-2-oxopiperidine-1-carboxylic acid (PubChem CID 141439632) has the molecular formula C22H27NO4Si and a molecular weight of 397.55 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-2-oxopiperidine-1-carboxylic acid.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-oxopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141439632 |
| Molecular Formula | C22H27NO4Si |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-oxopiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](OC1CCN(C(=O)O)C(=O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO4Si/c1-22(2,3)28(18-10-6-4-7-11-18,19-12-8-5-9-13-19)27-17-14-15-23(21(25)26)20(24)16-17/h4-13,17H,14-16H2,1-3H3,(H,25,26) |
| InChIKey | NFMXFUCBPFGRFM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|