C25H35NO2Si — CID 135391106
3-[tert-butyl(diphenyl)silyl]oxy-1-(2-methylpiperidin-1-yl)propan-1-one (PubChem CID 135391106) has the molecular formula C25H35NO2Si and a molecular weight of 409.65 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-1-(2-methylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-1-(2-methylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 135391106 |
| Molecular Formula | C25H35NO2Si |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-1-(2-methylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CCCCN1C(=O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H35NO2Si/c1-21-13-11-12-19-26(21)24(27)18-20-28-29(25(2,3)4,22-14-7-5-8-15-22)23-16-9-6-10-17-23/h5-10,14-17,21H,11-13,18-20H2,1-4H3 |
| InChIKey | FQCXWTVCYAGBKC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|