C25H36FNOSi — CID 135391118
tert-butyl-[2-fluoro-3-(2-methylpiperidin-1-yl)propoxy]-diphenylsilane (PubChem CID 135391118) has the molecular formula C25H36FNOSi and a molecular weight of 413.65 g/mol. Its IUPAC name is tert-butyl-[2-fluoro-3-(2-methylpiperidin-1-yl)propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-fluoro-3-(2-methylpiperidin-1-yl)propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135391118 |
| Molecular Formula | C25H36FNOSi |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | tert-butyl-[2-fluoro-3-(2-methylpiperidin-1-yl)propoxy]-diphenylsilane |
| SMILES | CC1CCCCN1CC(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36FNOSi/c1-21-13-11-12-18-27(21)19-22(26)20-28-29(25(2,3)4,23-14-7-5-8-15-23)24-16-9-6-10-17-24/h5-10,14-17,21-22H,11-13,18-20H2,1-4H3 |
| InChIKey | CFPGTQULJCICJF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|