C13H17NO2 — CID 141439696
(5S)-5-[(R)-(2,3-dimethylphenyl)-hydroxymethyl]pyrrolidin-2-one (PubChem CID 141439696) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (5S)-5-[(R)-(2,3-dimethylphenyl)-hydroxymethyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(R)-(2,3-dimethylphenyl)-hydroxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141439696 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (5S)-5-[(R)-(2,3-dimethylphenyl)-hydroxymethyl]pyrrolidin-2-one |
| SMILES | Cc1cccc([C@@H](O)[C@@H]2CCC(=O)N2)c1C |
| InChI | InChI=1S/C13H17NO2/c1-8-4-3-5-10(9(8)2)13(16)11-6-7-12(15)14-11/h3-5,11,13,16H,6-7H2,1-2H3,(H,14,15)/t11-,13+/m0/s1 |
| InChIKey | ZSQCGWKUNUOAAA-WCQYABFASA-N |
| XLogP | 1.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |