About 5-butylnonan-5-yl methyl carbonate
5-butylnonan-5-yl methyl carbonate (PubChem CID 141441033) has the molecular formula C15H30O3
and a molecular weight of 258.40 g/mol. Its IUPAC name is 5-butylnonan-5-yl methyl carbonate.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl methyl carbonate |
| PubChem CID | 141441033 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 5-butylnonan-5-yl methyl carbonate |
| SMILES | CCCCC(CCCC)(CCCC)OC(=O)OC |
| InChI | InChI=1S/C15H30O3/c1-5-8-11-15(12-9-6-2,13-10-7-3)18-14(16)17-4/h5-13H2,1-4H3 |
| InChIKey | DKJSJJFEIRNAOR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butylnonan-5-yl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl methyl carbonate?
The IUPAC name of 5-butylnonan-5-yl methyl carbonate (CID 141441033) is 5-butylnonan-5-yl methyl carbonate.
What is the SMILES notation for 5-butylnonan-5-yl methyl carbonate?
The canonical SMILES for 5-butylnonan-5-yl methyl carbonate is CCCCC(CCCC)(CCCC)OC(=O)OC.
What is the InChIKey of 5-butylnonan-5-yl methyl carbonate?
The InChIKey is DKJSJJFEIRNAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3/c1-5-8-11-15(12-9-6-2,13-10-7-3)18-14(16)17-4/h5-13H2,1-4H3.
What are the key properties of 5-butylnonan-5-yl methyl carbonate?
5-butylnonan-5-yl methyl carbonate has a molecular weight of 258.40 g/mol, XLogP of 5.08, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl methyl carbonate is sourced from PubChem (CID 141441033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).