About 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate
2-methylhexan-2-yl 2-methylpentan-3-yl carbonate (PubChem CID 129274077) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate.
Molecular Properties
| Compound Name | 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate |
| PubChem CID | 129274077 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate |
| SMILES | CCCCC(C)(C)OC(=O)OC(CC)C(C)C |
| InChI | InChI=1S/C14H28O3/c1-7-9-10-14(5,6)17-13(15)16-12(8-2)11(3)4/h11-12H,7-10H2,1-6H3 |
| InChIKey | HWLQXDQGRUXOTE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate?
The IUPAC name of 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate (CID 129274077) is 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate.
What is the SMILES notation for 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate?
The canonical SMILES for 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate is CCCCC(C)(C)OC(=O)OC(CC)C(C)C.
What is the InChIKey of 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate?
The InChIKey is HWLQXDQGRUXOTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3/c1-7-9-10-14(5,6)17-13(15)16-12(8-2)11(3)4/h11-12H,7-10H2,1-6H3.
What are the key properties of 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate?
2-methylhexan-2-yl 2-methylpentan-3-yl carbonate has a molecular weight of 244.37 g/mol, XLogP of 4.54, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexan-2-yl 2-methylpentan-3-yl carbonate is sourced from PubChem (CID 129274077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).