C17H12N4O4 — CID 141442262
N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)-4-methoxybenzamide (PubChem CID 141442262) has the molecular formula C17H12N4O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)-4-methoxybenzamide.
| Compound Name | N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 141442262 |
| Molecular Formula | C17H12N4O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(C#N)[n+]([O-])c3ccccc3[n+]2[O-])cc1 |
| InChI | InChI=1S/C17H12N4O4/c1-25-12-8-6-11(7-9-12)17(22)19-16-15(10-18)20(23)13-4-2-3-5-14(13)21(16)24/h2-9H,1H3,(H,19,22) |
| InChIKey | UDOMUQKJVNWEHD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|