C16H10N4O3 — CID 141442268
N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)benzamide (PubChem CID 141442268) has the molecular formula C16H10N4O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)benzamide.
| Compound Name | N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)benzamide |
|---|---|
| PubChem CID | 141442268 |
| Molecular Formula | C16H10N4O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)benzamide |
| SMILES | N#Cc1c(NC(=O)c2ccccc2)[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C16H10N4O3/c17-10-14-15(18-16(21)11-6-2-1-3-7-11)20(23)13-9-5-4-8-12(13)19(14)22/h1-9H,(H,18,21) |
| InChIKey | GFZBWQYZUXFAQC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|