C15H13BrN2O5S — CID 141444028
[1-(1-benzofuran-2-ylsulfonyl)-5-bromopyrrol-3-yl]methyl-methylcarbamic acid (PubChem CID 141444028) has the molecular formula C15H13BrN2O5S and a molecular weight of 413.25 g/mol. Its IUPAC name is [1-(1-benzofuran-2-ylsulfonyl)-5-bromopyrrol-3-yl]methyl-methylcarbamic acid.
| Compound Name | [1-(1-benzofuran-2-ylsulfonyl)-5-bromopyrrol-3-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 141444028 |
| Molecular Formula | C15H13BrN2O5S |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | [1-(1-benzofuran-2-ylsulfonyl)-5-bromopyrrol-3-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1cc(Br)n(S(=O)(=O)c2cc3ccccc3o2)c1)C(=O)O |
| InChI | InChI=1S/C15H13BrN2O5S/c1-17(15(19)20)8-10-6-13(16)18(9-10)24(21,22)14-7-11-4-2-3-5-12(11)23-14/h2-7,9H,8H2,1H3,(H,19,20) |
| InChIKey | HEQBTDKHFIOGGH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |