C14H15BrN2O6S2 — CID 69245343
[5-bromo-1-(3-methylsulfonylphenyl)sulfonylpyrrol-3-yl]methyl-methylcarbamic acid (PubChem CID 69245343) has the molecular formula C14H15BrN2O6S2 and a molecular weight of 451.32 g/mol. Its IUPAC name is [5-bromo-1-(3-methylsulfonylphenyl)sulfonylpyrrol-3-yl]methyl-methylcarbamic acid.
| Compound Name | [5-bromo-1-(3-methylsulfonylphenyl)sulfonylpyrrol-3-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 69245343 |
| Molecular Formula | C14H15BrN2O6S2 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | [5-bromo-1-(3-methylsulfonylphenyl)sulfonylpyrrol-3-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1cc(Br)n(S(=O)(=O)c2cccc(S(C)(=O)=O)c2)c1)C(=O)O |
| InChI | InChI=1S/C14H15BrN2O6S2/c1-16(14(18)19)8-10-6-13(15)17(9-10)25(22,23)12-5-3-4-11(7-12)24(2,20)21/h3-7,9H,8H2,1-2H3,(H,18,19) |
| InChIKey | AUFCXGIBOIPRST-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |