C19H18ClN3O4S — CID 87206751
[1-[(6-chloro-5-methyl-3-pyridinyl)sulfonyl]-5-phenylpyrrol-3-yl]methyl-methylcarbamic acid (PubChem CID 87206751) has the molecular formula C19H18ClN3O4S and a molecular weight of 419.89 g/mol. Its IUPAC name is [1-[(6-chloro-5-methyl-3-pyridinyl)sulfonyl]-5-phenylpyrrol-3-yl]methyl-methylcarbamic acid.
| Compound Name | [1-[(6-chloro-5-methyl-3-pyridinyl)sulfonyl]-5-phenylpyrrol-3-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 87206751 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | [1-[(6-chloro-5-methyl-3-pyridinyl)sulfonyl]-5-phenylpyrrol-3-yl]methyl-methylcarbamic acid |
| SMILES | Cc1cc(S(=O)(=O)n2cc(CN(C)C(=O)O)cc2-c2ccccc2)cnc1Cl |
| InChI | InChI=1S/C19H18ClN3O4S/c1-13-8-16(10-21-18(13)20)28(26,27)23-12-14(11-22(2)19(24)25)9-17(23)15-6-4-3-5-7-15/h3-10,12H,11H2,1-2H3,(H,24,25) |
| InChIKey | XIAPFGJUXONLOF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|