C29H52O7S — CID 141446498
4-[(2-methylpropan-2-yl)oxycarbonyl]-12-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]sulfanyl-5-oxododecanoic acid (PubChem CID 141446498) has the molecular formula C29H52O7S and a molecular weight of 544.80 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonyl]-12-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]sulfanyl-5-oxododecanoic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-12-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]sulfanyl-5-oxododecanoic acid |
|---|---|
| PubChem CID | 141446498 |
| Molecular Formula | C29H52O7S |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-12-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]sulfanyl-5-oxododecanoic acid |
| SMILES | CC(C)(C)OC(=O)CCCCCCCSCCCCCCCC(=O)C(CCC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H52O7S/c1-28(2,3)35-26(33)18-14-10-8-12-16-22-37-21-15-11-7-9-13-17-24(30)23(19-20-25(31)32)27(34)36-29(4,5)6/h23H,7-22H2,1-6H3,(H,31,32) |
| InChIKey | RZZDTEXCJMTQLJ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|