C10H8F9NO3S — CID 141446622
3-methylpyridin-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 141446622) has the molecular formula C10H8F9NO3S and a molecular weight of 393.23 g/mol. Its IUPAC name is 3-methylpyridin-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | 3-methylpyridin-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141446622 |
| Molecular Formula | C10H8F9NO3S |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 3-methylpyridin-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | Cc1ccc[nH+]c1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7N.C4HF9O3S/c1-6-3-2-4-7-5-6;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h2-5H,1H3;(H,14,15,16) |
| InChIKey | HSHPPCBSHRXRIV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|