C12H18N4O4 — CID 141447217
ethyl 2-[2-(4-amino-6-oxo-1H-pyridin-2-yl)ethylcarbamoylamino]acetate (PubChem CID 141447217) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is ethyl 2-[2-(4-amino-6-oxo-1H-pyridin-2-yl)ethylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[2-(4-amino-6-oxo-1H-pyridin-2-yl)ethylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 141447217 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | ethyl 2-[2-(4-amino-6-oxo-1H-pyridin-2-yl)ethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCCc1cc(N)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H18N4O4/c1-2-20-11(18)7-15-12(19)14-4-3-9-5-8(13)6-10(17)16-9/h5-6H,2-4,7H2,1H3,(H3,13,16,17)(H2,14,15,19) |
| InChIKey | QRHBQFMLLHYHST-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |