C23H21N3O2 — CID 141448054
3-[cyclopropyl(methyl)amino]-2-(2-methyl-1H-indol-5-yl)quinoline-6-carboxylic acid (PubChem CID 141448054) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[cyclopropyl(methyl)amino]-2-(2-methyl-1H-indol-5-yl)quinoline-6-carboxylic acid.
| Compound Name | 3-[cyclopropyl(methyl)amino]-2-(2-methyl-1H-indol-5-yl)quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 141448054 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 3-[cyclopropyl(methyl)amino]-2-(2-methyl-1H-indol-5-yl)quinoline-6-carboxylic acid |
| SMILES | Cc1cc2cc(-c3nc4ccc(C(=O)O)cc4cc3N(C)C3CC3)ccc2[nH]1 |
| InChI | InChI=1S/C23H21N3O2/c1-13-9-16-10-14(3-7-19(16)24-13)22-21(26(2)18-5-6-18)12-17-11-15(23(27)28)4-8-20(17)25-22/h3-4,7-12,18,24H,5-6H2,1-2H3,(H,27,28) |
| InChIKey | FWSRVWARLRCHAZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |