C19H17N3O2 — CID 175276154
2-[3-[cyclopropyl(methyl)amino]phenyl]quinoxaline-6-carboxylic acid (PubChem CID 175276154) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[3-[cyclopropyl(methyl)amino]phenyl]quinoxaline-6-carboxylic acid.
| Compound Name | 2-[3-[cyclopropyl(methyl)amino]phenyl]quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 175276154 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[3-[cyclopropyl(methyl)amino]phenyl]quinoxaline-6-carboxylic acid |
| SMILES | CN(c1cccc(-c2cnc3cc(C(=O)O)ccc3n2)c1)C1CC1 |
| InChI | InChI=1S/C19H17N3O2/c1-22(14-6-7-14)15-4-2-3-12(9-15)18-11-20-17-10-13(19(23)24)5-8-16(17)21-18/h2-5,8-11,14H,6-7H2,1H3,(H,23,24) |
| InChIKey | KBXOPUBYSYGYBN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |