C21H24BrNO5 — CID 141448113
ethyl 1-[1-(4-bromoanilino)-3-oxo-2-propoxyprop-2-enyl]-2-(oxomethylidene)cyclopentane-1-carboxylate (PubChem CID 141448113) has the molecular formula C21H24BrNO5 and a molecular weight of 450.33 g/mol. Its IUPAC name is ethyl 1-[1-(4-bromoanilino)-3-oxo-2-propoxyprop-2-enyl]-2-(oxomethylidene)cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-[1-(4-bromoanilino)-3-oxo-2-propoxyprop-2-enyl]-2-(oxomethylidene)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 141448113 |
| Molecular Formula | C21H24BrNO5 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | ethyl 1-[1-(4-bromoanilino)-3-oxo-2-propoxyprop-2-enyl]-2-(oxomethylidene)cyclopentane-1-carboxylate |
| SMILES | CCCOC(=C=O)C(Nc1ccc(Br)cc1)C1(C(=O)OCC)CCCC1=C=O |
| InChI | InChI=1S/C21H24BrNO5/c1-3-12-28-18(14-25)19(23-17-9-7-16(22)8-10-17)21(20(26)27-4-2)11-5-6-15(21)13-24/h7-10,19,23H,3-6,11-12H2,1-2H3 |
| InChIKey | DAMSHCKVRCKVRQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|