C18H22ClNO5 — CID 72793486
ethyl 1-[1-(4-chloroanilino)-2-ethoxy-2-oxoethyl]-2-oxocyclopentane-1-carboxylate (PubChem CID 72793486) has the molecular formula C18H22ClNO5 and a molecular weight of 367.83 g/mol. Its IUPAC name is ethyl 1-[1-(4-chloroanilino)-2-ethoxy-2-oxoethyl]-2-oxocyclopentane-1-carboxylate.
| Compound Name | ethyl 1-[1-(4-chloroanilino)-2-ethoxy-2-oxoethyl]-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 72793486 |
| Molecular Formula | C18H22ClNO5 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl 1-[1-(4-chloroanilino)-2-ethoxy-2-oxoethyl]-2-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C(Nc1ccc(Cl)cc1)C1(C(=O)OCC)CCCC1=O |
| InChI | InChI=1S/C18H22ClNO5/c1-3-24-16(22)15(20-13-9-7-12(19)8-10-13)18(17(23)25-4-2)11-5-6-14(18)21/h7-10,15,20H,3-6,11H2,1-2H3 |
| InChIKey | PTCZGCUZWFWYDM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|