C22H27BFNO4S — CID 141448876
1-[1,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonyl-7-fluoroindole (PubChem CID 141448876) has the molecular formula C22H27BFNO4S and a molecular weight of 431.34 g/mol. Its IUPAC name is 1-[1,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonyl-7-fluoroindole.
| Compound Name | 1-[1,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonyl-7-fluoroindole |
|---|---|
| PubChem CID | 141448876 |
| Molecular Formula | C22H27BFNO4S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-[1,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonyl-7-fluoroindole |
| SMILES | CC1=C(B2OC(C)(C)C(C)(C)O2)C=CC(C)(S(=O)(=O)n2ccc3cccc(F)c32)C1 |
| InChI | InChI=1S/C22H27BFNO4S/c1-15-14-22(6,12-10-17(15)23-28-20(2,3)21(4,5)29-23)30(26,27)25-13-11-16-8-7-9-18(24)19(16)25/h7-13H,14H2,1-6H3 |
| InChIKey | BNQJHQMUTLHHSL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|