About 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole
3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole (PubChem CID 11372738) has the molecular formula C19H16ClFN2O2S
and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole.
Molecular Properties
| Compound Name | 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole |
| PubChem CID | 11372738 |
| Molecular Formula | C19H16ClFN2O2S |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole |
| SMILES | CN1CC(Cl)=C(c2cn(S(=O)(=O)c3ccc(F)cc3)c3ccccc23)C1 |
| InChI | InChI=1S/C19H16ClFN2O2S/c1-22-10-17(18(20)12-22)16-11-23(19-5-3-2-4-15(16)19)26(24,25)14-8-6-13(21)7-9-14/h2-9,11H,10,12H2,1H3 |
| InChIKey | BSUNLXLBVQPAFJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole?
The IUPAC name of 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole (CID 11372738) is 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole.
What is the SMILES notation for 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole?
The canonical SMILES for 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole is CN1CC(Cl)=C(c2cn(S(=O)(=O)c3ccc(F)cc3)c3ccccc23)C1.
What is the InChIKey of 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole?
The InChIKey is BSUNLXLBVQPAFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClFN2O2S/c1-22-10-17(18(20)12-22)16-11-23(19-5-3-2-4-15(16)19)26(24,25)14-8-6-13(21)7-9-14/h2-9,11H,10,12H2,1H3.
What are the key properties of 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole?
3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole has a molecular weight of 390.87 g/mol, XLogP of 3.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-1-methyl-2,5-dihydropyrrol-3-yl)-1-(4-fluorophenyl)sulfonylindole is sourced from PubChem (CID 11372738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).