C23H28O9 — CID 141450792
bis(1-prop-2-enoyloxypropyl) 3-(2-hydroxypropyl)benzene-1,2-dicarboxylate (PubChem CID 141450792) has the molecular formula C23H28O9 and a molecular weight of 448.47 g/mol. Its IUPAC name is bis(1-prop-2-enoyloxypropyl) 3-(2-hydroxypropyl)benzene-1,2-dicarboxylate.
| Compound Name | bis(1-prop-2-enoyloxypropyl) 3-(2-hydroxypropyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 141450792 |
| Molecular Formula | C23H28O9 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | bis(1-prop-2-enoyloxypropyl) 3-(2-hydroxypropyl)benzene-1,2-dicarboxylate |
| SMILES | C=CC(=O)OC(CC)OC(=O)c1cccc(CC(C)O)c1C(=O)OC(CC)OC(=O)C=C |
| InChI | InChI=1S/C23H28O9/c1-6-17(25)29-19(8-3)31-22(27)16-12-10-11-15(13-14(5)24)21(16)23(28)32-20(9-4)30-18(26)7-2/h6-7,10-12,14,19-20,24H,1-2,8-9,13H2,3-5H3 |
| InChIKey | VTFPBNAYEIXYSO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|