C15H18N2O4 — CID 18934405
1-[2,3-bis(methylcarbamoyl)phenyl]ethyl prop-2-enoate (PubChem CID 18934405) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-[2,3-bis(methylcarbamoyl)phenyl]ethyl prop-2-enoate.
| Compound Name | 1-[2,3-bis(methylcarbamoyl)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 18934405 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[2,3-bis(methylcarbamoyl)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)c1cccc(C(=O)NC)c1C(=O)NC |
| InChI | InChI=1S/C15H18N2O4/c1-5-12(18)21-9(2)10-7-6-8-11(14(19)16-3)13(10)15(20)17-4/h5-9H,1H2,2-4H3,(H,16,19)(H,17,20) |
| InChIKey | DQLKANOAVFOFJE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|