C17H23NO5 — CID 66776977
2-aminoethyl 2-methylprop-2-enoate;1-(2-hydroxyphenyl)ethyl prop-2-enoate (PubChem CID 66776977) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-aminoethyl 2-methylprop-2-enoate;1-(2-hydroxyphenyl)ethyl prop-2-enoate.
| Compound Name | 2-aminoethyl 2-methylprop-2-enoate;1-(2-hydroxyphenyl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 66776977 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-aminoethyl 2-methylprop-2-enoate;1-(2-hydroxyphenyl)ethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN.C=CC(=O)OC(C)c1ccccc1O |
| InChI | InChI=1S/C11H12O3.C6H11NO2/c1-3-11(13)14-8(2)9-6-4-5-7-10(9)12;1-5(2)6(8)9-4-3-7/h3-8,12H,1H2,2H3;1,3-4,7H2,2H3 |
| InChIKey | DOBRWXGEYJVJPU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|