C15H20O4 — CID 174569324
2-hydroxyethyl 2-methylprop-2-enoate;2-prop-2-enylphenol (PubChem CID 174569324) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;2-prop-2-enylphenol.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-prop-2-enylphenol |
|---|---|
| PubChem CID | 174569324 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-prop-2-enylphenol |
| SMILES | C=C(C)C(=O)OCCO.C=CCc1ccccc1O |
| InChI | InChI=1S/C9H10O.C6H10O3/c1-2-5-8-6-3-4-7-9(8)10;1-5(2)6(8)9-4-3-7/h2-4,6-7,10H,1,5H2;7H,1,3-4H2,2H3 |
| InChIKey | GTUXZIWWWZLRPJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|