C10H13N3O3 — CID 141451014
(2S)-2-amino-3-[2-(carbamoylamino)phenyl]propanoic acid (PubChem CID 141451014) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(carbamoylamino)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(carbamoylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 141451014 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (2S)-2-amino-3-[2-(carbamoylamino)phenyl]propanoic acid |
| SMILES | NC(=O)Nc1ccccc1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H13N3O3/c11-7(9(14)15)5-6-3-1-2-4-8(6)13-10(12)16/h1-4,7H,5,11H2,(H,14,15)(H3,12,13,16)/t7-/m0/s1 |
| InChIKey | VJIRUDXPBNYENS-ZETCQYMHSA-N |
| XLogP | 0.13 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |