C12H17N3O3S — CID 44547117
2-amino-3-[2-amino-3-(2-sulfanylpropanoylamino)phenyl]propanoic acid (PubChem CID 44547117) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-amino-3-[2-amino-3-(2-sulfanylpropanoylamino)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[2-amino-3-(2-sulfanylpropanoylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 44547117 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-amino-3-[2-amino-3-(2-sulfanylpropanoylamino)phenyl]propanoic acid |
| SMILES | CC(S)C(=O)Nc1cccc(CC(N)C(=O)O)c1N |
| InChI | InChI=1S/C12H17N3O3S/c1-6(19)11(16)15-9-4-2-3-7(10(9)14)5-8(13)12(17)18/h2-4,6,8,19H,5,13-14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | UHMFLCURFHVJAM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|