C10H13ClINO2 — CID 162344777
(2R)-2-amino-3-(3-iodo-2-methylphenyl)propanoic acid;hydrochloride (PubChem CID 162344777) has the molecular formula C10H13ClINO2 and a molecular weight of 341.58 g/mol. Its IUPAC name is (2R)-2-amino-3-(3-iodo-2-methylphenyl)propanoic acid;hydrochloride.
| Compound Name | (2R)-2-amino-3-(3-iodo-2-methylphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 162344777 |
| Molecular Formula | C10H13ClINO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | (2R)-2-amino-3-(3-iodo-2-methylphenyl)propanoic acid;hydrochloride |
| SMILES | Cc1c(I)cccc1C[C@@H](N)C(=O)O.Cl |
| InChI | InChI=1S/C10H12INO2.ClH/c1-6-7(3-2-4-8(6)11)5-9(12)10(13)14;/h2-4,9H,5,12H2,1H3,(H,13,14);1H/t9-;/m1./s1 |
| InChIKey | WEJHMPYGFWWNJC-SBSPUUFOSA-N |
| XLogP | 1.98 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|