C25H21ClF7NO2 — CID 141453583
methyl 2-chloro-5-[1-[4-(1,1,1,4,5,5,5-heptafluoropentan-2-yl)-2,6-dimethylphenyl]pyrrol-3-yl]benzoate (PubChem CID 141453583) has the molecular formula C25H21ClF7NO2 and a molecular weight of 535.89 g/mol. Its IUPAC name is methyl 2-chloro-5-[1-[4-(1,1,1,4,5,5,5-heptafluoropentan-2-yl)-2,6-dimethylphenyl]pyrrol-3-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[1-[4-(1,1,1,4,5,5,5-heptafluoropentan-2-yl)-2,6-dimethylphenyl]pyrrol-3-yl]benzoate |
|---|---|
| PubChem CID | 141453583 |
| Molecular Formula | C25H21ClF7NO2 |
| Molecular Weight | 535.89 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | methyl 2-chloro-5-[1-[4-(1,1,1,4,5,5,5-heptafluoropentan-2-yl)-2,6-dimethylphenyl]pyrrol-3-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2ccn(-c3c(C)cc(C(CC(F)C(F)(F)F)C(F)(F)F)cc3C)c2)ccc1Cl |
| InChI | InChI=1S/C25H21ClF7NO2/c1-13-8-17(19(24(28,29)30)11-21(27)25(31,32)33)9-14(2)22(13)34-7-6-16(12-34)15-4-5-20(26)18(10-15)23(35)36-3/h4-10,12,19,21H,11H2,1-3H3 |
| InChIKey | XRHCYUKAGYKYRS-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.89 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |