C16H18O4 — CID 141454268
ethyl 6-ethyl-2-oxo-4-phenyl-3,4-dihydropyran-5-carboxylate (PubChem CID 141454268) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 6-ethyl-2-oxo-4-phenyl-3,4-dihydropyran-5-carboxylate.
| Compound Name | ethyl 6-ethyl-2-oxo-4-phenyl-3,4-dihydropyran-5-carboxylate |
|---|---|
| PubChem CID | 141454268 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | ethyl 6-ethyl-2-oxo-4-phenyl-3,4-dihydropyran-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CC)OC(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C16H18O4/c1-3-13-15(16(18)19-4-2)12(10-14(17)20-13)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | TUYOKUYATPKHPE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |