C15H18N2O3 — CID 141455313
[(3-methyl-1H-indole-2-carbonyl)amino] 2,2-dimethylpropanoate (PubChem CID 141455313) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is [(3-methyl-1H-indole-2-carbonyl)amino] 2,2-dimethylpropanoate.
| Compound Name | [(3-methyl-1H-indole-2-carbonyl)amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 141455313 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [(3-methyl-1H-indole-2-carbonyl)amino] 2,2-dimethylpropanoate |
| SMILES | Cc1c(C(=O)NOC(=O)C(C)(C)C)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H18N2O3/c1-9-10-7-5-6-8-11(10)16-12(9)13(18)17-20-14(19)15(2,3)4/h5-8,16H,1-4H3,(H,17,18) |
| InChIKey | NLNUGQLFPBKRBB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|