C13H30NO2+ — CID 141455394
9,9-dihydroxydecan-5-yl(trimethyl)azanium (PubChem CID 141455394) has the molecular formula C13H30NO2+ and a molecular weight of 232.39 g/mol. Its IUPAC name is 9,9-dihydroxydecan-5-yl(trimethyl)azanium.
| Compound Name | 9,9-dihydroxydecan-5-yl(trimethyl)azanium |
|---|---|
| PubChem CID | 141455394 |
| Molecular Formula | C13H30NO2+ |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.23 |
| IUPAC Name | 9,9-dihydroxydecan-5-yl(trimethyl)azanium |
| SMILES | CCCCC(CCCC(C)(O)O)[N+](C)(C)C |
| InChI | InChI=1S/C13H30NO2/c1-6-7-9-12(14(3,4)5)10-8-11-13(2,15)16/h12,15-16H,6-11H2,1-5H3/q+1 |
| InChIKey | XRJFCBSTBJIERG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|