About tetra(octan-4-yl)azanium fluoride
tetra(octan-4-yl)azanium fluoride (PubChem CID 87832016) has the molecular formula C32H68FN
and a molecular weight of 485.90 g/mol. Its IUPAC name is tetra(octan-4-yl)azanium fluoride.
Molecular Properties
| Compound Name | tetra(octan-4-yl)azanium fluoride |
| PubChem CID | 87832016 |
| Molecular Formula | C32H68FN |
| Molecular Weight | 485.90 g/mol |
| Exact Mass | 485.53 |
| IUPAC Name | tetra(octan-4-yl)azanium fluoride |
| SMILES | CCCCC(CCC)[N+](C(CCC)CCCC)(C(CCC)CCCC)C(CCC)CCCC.[F-] |
| InChI | InChI=1S/C32H68N.FH/c1-9-17-25-29(21-13-5)33(30(22-14-6)26-18-10-2,31(23-15-7)27-19-11-3)32(24-16-8)28-20-12-4;/h29-32H,9-28H2,1-8H3;1H/q+1;/p-1 |
| InChIKey | RYIQVCHGPXYNJM-UHFFFAOYSA-M |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.90 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetra(octan-4-yl)azanium fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetra(octan-4-yl)azanium fluoride?
The IUPAC name of tetra(octan-4-yl)azanium fluoride (CID 87832016) is tetra(octan-4-yl)azanium fluoride.
What is the SMILES notation for tetra(octan-4-yl)azanium fluoride?
The canonical SMILES for tetra(octan-4-yl)azanium fluoride is CCCCC(CCC)[N+](C(CCC)CCCC)(C(CCC)CCCC)C(CCC)CCCC.[F-].
What is the InChIKey of tetra(octan-4-yl)azanium fluoride?
The InChIKey is RYIQVCHGPXYNJM-UHFFFAOYSA-M. The full InChI is InChI=1S/C32H68N.FH/c1-9-17-25-29(21-13-5)33(30(22-14-6)26-18-10-2,31(23-15-7)27-19-11-3)32(24-16-8)28-20-12-4;/h29-32H,9-28H2,1-8H3;1H/q+1;/p-1.
What are the key properties of tetra(octan-4-yl)azanium fluoride?
tetra(octan-4-yl)azanium fluoride has a molecular weight of 485.90 g/mol, XLogP of 8.24, 24 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetra(octan-4-yl)azanium fluoride is sourced from PubChem (CID 87832016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).