C32H26F3N3O4 — CID 141461836
3-[[4-[(1S)-1-[6-(4-methoxyphenyl)-3-(3,4,5-trifluorophenyl)indazol-1-yl]ethyl]benzoyl]amino]propanoic acid (PubChem CID 141461836) has the molecular formula C32H26F3N3O4 and a molecular weight of 573.57 g/mol. Its IUPAC name is 3-[[4-[(1S)-1-[6-(4-methoxyphenyl)-3-(3,4,5-trifluorophenyl)indazol-1-yl]ethyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(1S)-1-[6-(4-methoxyphenyl)-3-(3,4,5-trifluorophenyl)indazol-1-yl]ethyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 141461836 |
| Molecular Formula | C32H26F3N3O4 |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 3-[[4-[(1S)-1-[6-(4-methoxyphenyl)-3-(3,4,5-trifluorophenyl)indazol-1-yl]ethyl]benzoyl]amino]propanoic acid |
| SMILES | COc1ccc(-c2ccc3c(-c4cc(F)c(F)c(F)c4)nn([C@@H](C)c4ccc(C(=O)NCCC(=O)O)cc4)c3c2)cc1 |
| InChI | InChI=1S/C32H26F3N3O4/c1-18(19-3-5-21(6-4-19)32(41)36-14-13-29(39)40)38-28-17-22(20-7-10-24(42-2)11-8-20)9-12-25(28)31(37-38)23-15-26(33)30(35)27(34)16-23/h3-12,15-18H,13-14H2,1-2H3,(H,36,41)(H,39,40)/t18-/m0/s1 |
| InChIKey | YWTXSMSIJJHIDP-SFHVURJKSA-N |
| XLogP | 6.61 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|