C6H4N2O3 — CID 141461949
3,7-dihydrofuro[3,4-d]pyrimidine-4,5-dione (PubChem CID 141461949) has the molecular formula C6H4N2O3 and a molecular weight of 152.11 g/mol. Its IUPAC name is 3,7-dihydrofuro[3,4-d]pyrimidine-4,5-dione.
| Compound Name | 3,7-dihydrofuro[3,4-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 141461949 |
| Molecular Formula | C6H4N2O3 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 3,7-dihydrofuro[3,4-d]pyrimidine-4,5-dione |
| SMILES | O=C1OCc2nc[nH]c(=O)c21 |
| InChI | InChI=1S/C6H4N2O3/c9-5-4-3(7-2-8-5)1-11-6(4)10/h2H,1H2,(H,7,8,9) |
| InChIKey | IJXJELKTUTYAHL-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |