C20H30N4O2 — CID 141462040
6-[4-[2-[methyl(propyl)amino]ethylamino]butoxy]-2-phenylpyridazin-3-one (PubChem CID 141462040) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 6-[4-[2-[methyl(propyl)amino]ethylamino]butoxy]-2-phenylpyridazin-3-one.
| Compound Name | 6-[4-[2-[methyl(propyl)amino]ethylamino]butoxy]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 141462040 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 6-[4-[2-[methyl(propyl)amino]ethylamino]butoxy]-2-phenylpyridazin-3-one |
| SMILES | CCCN(C)CCNCCCCOc1ccc(=O)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H30N4O2/c1-3-15-23(2)16-14-21-13-7-8-17-26-19-11-12-20(25)24(22-19)18-9-5-4-6-10-18/h4-6,9-12,21H,3,7-8,13-17H2,1-2H3 |
| InChIKey | DBQZGKCDIWOXEY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|