C12H17NO — CID 14146229
2-(7-ethyl-2,3-dihydro-1H-indol-3-yl)ethanol (PubChem CID 14146229) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(7-ethyl-2,3-dihydro-1H-indol-3-yl)ethanol.
| Compound Name | 2-(7-ethyl-2,3-dihydro-1H-indol-3-yl)ethanol |
|---|---|
| PubChem CID | 14146229 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-(7-ethyl-2,3-dihydro-1H-indol-3-yl)ethanol |
| SMILES | CCc1cccc2c1NCC2CCO |
| InChI | InChI=1S/C12H17NO/c1-2-9-4-3-5-11-10(6-7-14)8-13-12(9)11/h3-5,10,13-14H,2,6-8H2,1H3 |
| InChIKey | WQHGTUYNOTUVDR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |