C23H26ClNS3 — CID 141462781
N,1,1-tris(benzylsulfanyl)ethanamine;hydrochloride (PubChem CID 141462781) has the molecular formula C23H26ClNS3 and a molecular weight of 448.12 g/mol. Its IUPAC name is N,1,1-tris(benzylsulfanyl)ethanamine;hydrochloride.
| Compound Name | N,1,1-tris(benzylsulfanyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 141462781 |
| Molecular Formula | C23H26ClNS3 |
| Molecular Weight | 448.12 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N,1,1-tris(benzylsulfanyl)ethanamine;hydrochloride |
| SMILES | CC(NSCc1ccccc1)(SCc1ccccc1)SCc1ccccc1.Cl |
| InChI | InChI=1S/C23H25NS3.ClH/c1-23(25-17-20-11-5-2-6-12-20,26-18-21-13-7-3-8-14-21)24-27-19-22-15-9-4-10-16-22;/h2-16,24H,17-19H2,1H3;1H |
| InChIKey | AJIUNQLDDSKCQS-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.12 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|