C20H18F2N4O2 — CID 141466771
(2R,3S)-2-(2,4-difluorophenyl)-5-(6-methoxy-3-pyridinyl)-3-methyl-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol (PubChem CID 141466771) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is (2R,3S)-2-(2,4-difluorophenyl)-5-(6-methoxy-3-pyridinyl)-3-methyl-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol.
| Compound Name | (2R,3S)-2-(2,4-difluorophenyl)-5-(6-methoxy-3-pyridinyl)-3-methyl-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol |
|---|---|
| PubChem CID | 141466771 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (2R,3S)-2-(2,4-difluorophenyl)-5-(6-methoxy-3-pyridinyl)-3-methyl-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol |
| SMILES | COc1ccc(C#C[C@H](C)[C@](O)(Cn2cncn2)c2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C20H18F2N4O2/c1-14(3-4-15-5-8-19(28-2)24-10-15)20(27,11-26-13-23-12-25-26)17-7-6-16(21)9-18(17)22/h5-10,12-14,27H,11H2,1-2H3/t14-,20+/m0/s1 |
| InChIKey | IOAOWPPBFNDVLW-VBKZILBWSA-N |
| XLogP | 2.54 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|