C18H14F3N5O — CID 141466780
(2R,3S)-2-(2,4-difluorophenyl)-5-(5-fluoropyrimidin-4-yl)-3-methyl-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol (PubChem CID 141466780) has the molecular formula C18H14F3N5O and a molecular weight of 373.34 g/mol. Its IUPAC name is (2R,3S)-2-(2,4-difluorophenyl)-5-(5-fluoropyrimidin-4-yl)-3-methyl-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol.
| Compound Name | (2R,3S)-2-(2,4-difluorophenyl)-5-(5-fluoropyrimidin-4-yl)-3-methyl-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol |
|---|---|
| PubChem CID | 141466780 |
| Molecular Formula | C18H14F3N5O |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (2R,3S)-2-(2,4-difluorophenyl)-5-(5-fluoropyrimidin-4-yl)-3-methyl-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol |
| SMILES | C[C@@H](C#Cc1ncncc1F)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H14F3N5O/c1-12(2-5-17-16(21)7-22-9-24-17)18(27,8-26-11-23-10-25-26)14-4-3-13(19)6-15(14)20/h3-4,6-7,9-12,27H,8H2,1H3/t12-,18+/m0/s1 |
| InChIKey | LZVCAJSQSXNWJN-KPZWWZAWSA-N |
| XLogP | 2.06 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|