About azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone
azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone (PubChem CID 141468109) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone.
Molecular Properties
| Compound Name | azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone |
| PubChem CID | 141468109 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone |
| SMILES | C[C@@H]1CNC[C@H](C(=O)N2CCC2)O1 |
| InChI | InChI=1S/C9H16N2O2/c1-7-5-10-6-8(13-7)9(12)11-3-2-4-11/h7-8,10H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | WUYKEVGKPFWRGZ-HTQZYQBOSA-N |
| XLogP | -0.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone?
The IUPAC name of azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone (CID 141468109) is azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone.
What is the SMILES notation for azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone?
The canonical SMILES for azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone is C[C@@H]1CNC[C@H](C(=O)N2CCC2)O1.
What is the InChIKey of azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone?
The InChIKey is WUYKEVGKPFWRGZ-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-7-5-10-6-8(13-7)9(12)11-3-2-4-11/h7-8,10H,2-6H2,1H3/t7-,8-/m1/s1.
What are the key properties of azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone?
azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone has a molecular weight of 184.24 g/mol, XLogP of -0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-1-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone is sourced from PubChem (CID 141468109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).