About 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole
4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole (PubChem CID 141468334) has the molecular formula C18H12F5NOS
and a molecular weight of 385.36 g/mol. Its IUPAC name is 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole.
Molecular Properties
| Compound Name | 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole |
| PubChem CID | 141468334 |
| Molecular Formula | C18H12F5NOS |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole |
| SMILES | Cc1ccc(-c2nsc(C(F)(F)F)c2COc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C18H12F5NOS/c1-10-5-7-11(8-6-10)15-12(17(26-24-15)18(21,22)23)9-25-16-13(19)3-2-4-14(16)20/h2-8H,9H2,1H3 |
| InChIKey | XLYAVTPRWMGFHG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole?
The IUPAC name of 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole (CID 141468334) is 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole.
What is the SMILES notation for 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole?
The canonical SMILES for 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole is Cc1ccc(-c2nsc(C(F)(F)F)c2COc2c(F)cccc2F)cc1.
What is the InChIKey of 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole?
The InChIKey is XLYAVTPRWMGFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F5NOS/c1-10-5-7-11(8-6-10)15-12(17(26-24-15)18(21,22)23)9-25-16-13(19)3-2-4-14(16)20/h2-8H,9H2,1H3.
What are the key properties of 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole?
4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole has a molecular weight of 385.36 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-difluorophenoxy)methyl]-3-(4-methylphenyl)-5-(trifluoromethyl)-1,2-thiazole is sourced from PubChem (CID 141468334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).