About 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole
3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole (PubChem CID 141468358) has the molecular formula C17H9ClF5NOS
and a molecular weight of 405.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole |
| PubChem CID | 141468358 |
| Molecular Formula | C17H9ClF5NOS |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole |
| SMILES | Fc1cccc(F)c1OCc1c(-c2ccc(Cl)cc2)nsc1C(F)(F)F |
| InChI | InChI=1S/C17H9ClF5NOS/c18-10-6-4-9(5-7-10)14-11(16(26-24-14)17(21,22)23)8-25-15-12(19)2-1-3-13(15)20/h1-7H,8H2 |
| InChIKey | LFXJGEACOCVXQG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole?
The IUPAC name of 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole (CID 141468358) is 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole.
What is the SMILES notation for 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole?
The canonical SMILES for 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole is Fc1cccc(F)c1OCc1c(-c2ccc(Cl)cc2)nsc1C(F)(F)F.
What is the InChIKey of 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole?
The InChIKey is LFXJGEACOCVXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF5NOS/c18-10-6-4-9(5-7-10)14-11(16(26-24-14)17(21,22)23)8-25-15-12(19)2-1-3-13(15)20/h1-7H,8H2.
What are the key properties of 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole?
3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole has a molecular weight of 405.78 g/mol, XLogP of 6.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-4-[(2,6-difluorophenoxy)methyl]-5-(trifluoromethyl)-1,2-thiazole is sourced from PubChem (CID 141468358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).