C12H9ClF3NO3S2 — CID 174996624
methyl [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanesulfonate (PubChem CID 174996624) has the molecular formula C12H9ClF3NO3S2 and a molecular weight of 371.79 g/mol. Its IUPAC name is methyl [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanesulfonate.
| Compound Name | methyl [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanesulfonate |
|---|---|
| PubChem CID | 174996624 |
| Molecular Formula | C12H9ClF3NO3S2 |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | methyl [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanesulfonate |
| SMILES | COS(=O)(=O)Cc1c(-c2ccc(Cl)cc2)nsc1C(F)(F)F |
| InChI | InChI=1S/C12H9ClF3NO3S2/c1-20-22(18,19)6-9-10(7-2-4-8(13)5-3-7)17-21-11(9)12(14,15)16/h2-5H,6H2,1H3 |
| InChIKey | KNCIXLCEZYVUQS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|