C22H21ClF5NO2S — CID 166656961
(4E,6Z,8E)-7-[[3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methoxy]-6,8-difluoro-2-methyldeca-4,6,8-trien-1-ol (PubChem CID 166656961) has the molecular formula C22H21ClF5NO2S and a molecular weight of 493.93 g/mol. Its IUPAC name is (4E,6Z,8E)-7-[[3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methoxy]-6,8-difluoro-2-methyldeca-4,6,8-trien-1-ol.
| Compound Name | (4E,6Z,8E)-7-[[3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methoxy]-6,8-difluoro-2-methyldeca-4,6,8-trien-1-ol |
|---|---|
| PubChem CID | 166656961 |
| Molecular Formula | C22H21ClF5NO2S |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | (4E,6Z,8E)-7-[[3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methoxy]-6,8-difluoro-2-methyldeca-4,6,8-trien-1-ol |
| SMILES | C/C=C(F)\C(OCc1c(-c2ccc(Cl)cc2)nsc1C(F)(F)F)=C(F)/C=C/CC(C)CO |
| InChI | InChI=1S/C22H21ClF5NO2S/c1-3-17(24)20(18(25)6-4-5-13(2)11-30)31-12-16-19(14-7-9-15(23)10-8-14)29-32-21(16)22(26,27)28/h3-4,6-10,13,30H,5,11-12H2,1-2H3/b6-4+,17-3+,20-18- |
| InChIKey | JRPDZQFMZGLDQD-WBLNJESNSA-N |
| XLogP | 7.63 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|