C13H10F5NO4S2 — CID 174996383
methyl [3-(2,6-difluoro-4-methoxyphenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanesulfonate (PubChem CID 174996383) has the molecular formula C13H10F5NO4S2 and a molecular weight of 403.35 g/mol. Its IUPAC name is methyl [3-(2,6-difluoro-4-methoxyphenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanesulfonate.
| Compound Name | methyl [3-(2,6-difluoro-4-methoxyphenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanesulfonate |
|---|---|
| PubChem CID | 174996383 |
| Molecular Formula | C13H10F5NO4S2 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | methyl [3-(2,6-difluoro-4-methoxyphenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanesulfonate |
| SMILES | COc1cc(F)c(-c2nsc(C(F)(F)F)c2CS(=O)(=O)OC)c(F)c1 |
| InChI | InChI=1S/C13H10F5NO4S2/c1-22-6-3-8(14)10(9(15)4-6)11-7(5-25(20,21)23-2)12(24-19-11)13(16,17)18/h3-4H,5H2,1-2H3 |
| InChIKey | BMZURSYWDIANCQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|