About 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole
3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole (PubChem CID 134531950) has the molecular formula C12H13F2NO2
and a molecular weight of 241.24 g/mol. Its IUPAC name is 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole |
| PubChem CID | 134531950 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole |
| SMILES | COC1=NCC(c2c(F)cc(OC)cc2F)C1 |
| InChI | InChI=1S/C12H13F2NO2/c1-16-8-4-9(13)12(10(14)5-8)7-3-11(17-2)15-6-7/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | YELHWOSUGIJSBE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole?
The IUPAC name of 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole (CID 134531950) is 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole is COC1=NCC(c2c(F)cc(OC)cc2F)C1.
What is the InChIKey of 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole?
The InChIKey is YELHWOSUGIJSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO2/c1-16-8-4-9(13)12(10(14)5-8)7-3-11(17-2)15-6-7/h4-5,7H,3,6H2,1-2H3.
What are the key properties of 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole?
3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole has a molecular weight of 241.24 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-difluoro-4-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 134531950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).