C13H17F2NO2S — CID 166897808
1-tert-butylsulfinyl-2-(2,6-difluoro-4-methoxyphenyl)aziridine (PubChem CID 166897808) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-tert-butylsulfinyl-2-(2,6-difluoro-4-methoxyphenyl)aziridine.
| Compound Name | 1-tert-butylsulfinyl-2-(2,6-difluoro-4-methoxyphenyl)aziridine |
|---|---|
| PubChem CID | 166897808 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-tert-butylsulfinyl-2-(2,6-difluoro-4-methoxyphenyl)aziridine |
| SMILES | COc1cc(F)c(C2CN2S(=O)C(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C13H17F2NO2S/c1-13(2,3)19(17)16-7-11(16)12-9(14)5-8(18-4)6-10(12)15/h5-6,11H,7H2,1-4H3 |
| InChIKey | BJFJPKHFEZHSIP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|