C17H21F2N5O3 — CID 144851547
4-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one;formamide;N-methylpyrazin-2-amine (PubChem CID 144851547) has the molecular formula C17H21F2N5O3 and a molecular weight of 381.38 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one;formamide;N-methylpyrazin-2-amine.
| Compound Name | 4-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one;formamide;N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 144851547 |
| Molecular Formula | C17H21F2N5O3 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one;formamide;N-methylpyrazin-2-amine |
| SMILES | CNc1cnccn1.COc1cc(F)c(C2CNC(=O)C2)c(F)c1.NC=O |
| InChI | InChI=1S/C11H11F2NO2.C5H7N3.CH3NO/c1-16-7-3-8(12)11(9(13)4-7)6-2-10(15)14-5-6;1-6-5-4-7-2-3-8-5;2-1-3/h3-4,6H,2,5H2,1H3,(H,14,15);2-4H,1H3,(H,6,8);1H,(H2,2,3) |
| InChIKey | PHGIGZLCKWONNC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|