C8H4I3N — CID 141468614
2-(2,3,4-triiodophenyl)acetonitrile (PubChem CID 141468614) has the molecular formula C8H4I3N and a molecular weight of 494.84 g/mol. Its IUPAC name is 2-(2,3,4-triiodophenyl)acetonitrile.
| Compound Name | 2-(2,3,4-triiodophenyl)acetonitrile |
|---|---|
| PubChem CID | 141468614 |
| Molecular Formula | C8H4I3N |
| Molecular Weight | 494.84 g/mol |
| Exact Mass | 494.75 |
| IUPAC Name | 2-(2,3,4-triiodophenyl)acetonitrile |
| SMILES | N#CCc1ccc(I)c(I)c1I |
| InChI | InChI=1S/C8H4I3N/c9-6-2-1-5(3-4-12)7(10)8(6)11/h1-2H,3H2 |
| InChIKey | DBFPMOPGWMBQMA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|