C7H8F3N3O — CID 141469888
1,4-dimethyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 141469888) has the molecular formula C7H8F3N3O and a molecular weight of 207.16 g/mol. Its IUPAC name is 1,4-dimethyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1,4-dimethyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 141469888 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 1,4-dimethyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cc1c(C(F)(F)F)nn(C)c1C(N)=O |
| InChI | InChI=1S/C7H8F3N3O/c1-3-4(6(11)14)13(2)12-5(3)7(8,9)10/h1-2H3,(H2,11,14) |
| InChIKey | NKYGBXIXBLTWJS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |